C8H13BrO — CID 125455786
(3aR,6aS)-3a-(bromomethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan (PubChem CID 125455786) has the molecular formula C8H13BrO and a molecular weight of 205.09 g/mol. Its IUPAC name is (3aR,6aS)-3a-(bromomethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan.
| Compound Name | (3aR,6aS)-3a-(bromomethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan |
|---|---|
| PubChem CID | 125455786 |
| Molecular Formula | C8H13BrO |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | (3aR,6aS)-3a-(bromomethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan |
| SMILES | BrC[C@@]12CCC[C@@H]1OCC2 |
| InChI | InChI=1S/C8H13BrO/c9-6-8-3-1-2-7(8)10-5-4-8/h7H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | DMSVBJULIPFSJF-YUMQZZPRSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|