C11H19NO3 — CID 165450852
methyl 2-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methylamino]acetate (PubChem CID 165450852) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 2-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methylamino]acetate.
| Compound Name | methyl 2-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methylamino]acetate |
|---|---|
| PubChem CID | 165450852 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl 2-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methylamino]acetate |
| SMILES | COC(=O)CNC[C@]12CCC[C@H]1OCC2 |
| InChI | InChI=1S/C11H19NO3/c1-14-10(13)7-12-8-11-4-2-3-9(11)15-6-5-11/h9,12H,2-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | GMTDNJIOFUMUGZ-MWLCHTKSSA-N |
| XLogP | 0.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |