C17H20F2N2O2 — CID 167899844
N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-4,7-difluoro-2,3-dihydroindole-1-carboxamide (PubChem CID 167899844) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-4,7-difluoro-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-4,7-difluoro-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 167899844 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-4,7-difluoro-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(NC[C@]12CCC[C@H]1OCC2)N1CCc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C17H20F2N2O2/c18-12-3-4-13(19)15-11(12)5-8-21(15)16(22)20-10-17-6-1-2-14(17)23-9-7-17/h3-4,14H,1-2,5-10H2,(H,20,22)/t14-,17-/m1/s1 |
| InChIKey | FGZVXFGPWYKBIL-RHSMWYFYSA-N |
| XLogP | 3.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |