C16H25N3O2 — CID 136586822
N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide (PubChem CID 136586822) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide.
| Compound Name | N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 136586822 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide |
| SMILES | Cc1n[nH]c(C)c1CCC(=O)NC[C@]12CCC[C@H]1OCC2 |
| InChI | InChI=1S/C16H25N3O2/c1-11-13(12(2)19-18-11)5-6-15(20)17-10-16-7-3-4-14(16)21-9-8-16/h14H,3-10H2,1-2H3,(H,17,20)(H,18,19)/t14-,16-/m1/s1 |
| InChIKey | LFMIYQJUGQULEG-GDBMZVCRSA-N |
| XLogP | 2.03 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |