C15H21NO3 — CID 164632647
N-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(furan-2-yl)propanamide (PubChem CID 164632647) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 164632647 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-(furan-2-yl)propanamide |
| SMILES | O=C(CCc1ccco1)NC[C@@]12CCC[C@@H]1OCC2 |
| InChI | InChI=1S/C15H21NO3/c17-14(6-5-12-3-2-9-18-12)16-11-15-7-1-4-13(15)19-10-8-15/h2-3,9,13H,1,4-8,10-11H2,(H,16,17)/t13-,15-/m0/s1 |
| InChIKey | RVLXWLRJOZPGSX-ZFWWWQNUSA-N |
| XLogP | 2.29 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |