C15H27N3O4S — CID 138010322
1-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-[3-(methanesulfonamido)cyclobutyl]-1-methylurea (PubChem CID 138010322) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-[3-(methanesulfonamido)cyclobutyl]-1-methylurea.
| Compound Name | 1-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-[3-(methanesulfonamido)cyclobutyl]-1-methylurea |
|---|---|
| PubChem CID | 138010322 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[[(3aR,6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-3-[3-(methanesulfonamido)cyclobutyl]-1-methylurea |
| SMILES | CN(C[C@]12CCC[C@H]1OCC2)C(=O)NC1CC(NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H27N3O4S/c1-18(10-15-5-3-4-13(15)22-7-6-15)14(19)16-11-8-12(9-11)17-23(2,20)21/h11-13,17H,3-10H2,1-2H3,(H,16,19)/t11?,12?,13-,15-/m1/s1 |
| InChIKey | RDUJCGUHPJISCA-UJFKTDLFSA-N |
| XLogP | 0.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |