C13H23NO — CID 178197076
[(1R,3R)-3-[(6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]-2,2-dimethylcyclopropyl]methanamine (PubChem CID 178197076) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is [(1R,3R)-3-[(6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]-2,2-dimethylcyclopropyl]methanamine.
| Compound Name | [(1R,3R)-3-[(6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]-2,2-dimethylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 178197076 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | [(1R,3R)-3-[(6aR)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]-2,2-dimethylcyclopropyl]methanamine |
| SMILES | CC1(C)[C@H](CN)[C@H]1C12CCC[C@H]1OCC2 |
| InChI | InChI=1S/C13H23NO/c1-12(2)9(8-14)11(12)13-5-3-4-10(13)15-7-6-13/h9-11H,3-8,14H2,1-2H3/t9-,10-,11-,13?/m1/s1 |
| InChIKey | XRIUFXRBNNQGDX-RUPPFBPSSA-N |
| XLogP | 2.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |