C10H15NO2 — CID 130541965
5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptane-2-carbonitrile (PubChem CID 130541965) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptane-2-carbonitrile.
| Compound Name | 5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptane-2-carbonitrile |
|---|---|
| PubChem CID | 130541965 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptane-2-carbonitrile |
| SMILES | CC1(C)CC2(OC2C#N)C(C)(C)O1 |
| InChI | InChI=1S/C10H15NO2/c1-8(2)6-10(7(5-11)12-10)9(3,4)13-8/h7H,6H2,1-4H3 |
| InChIKey | AVUBTMVARHXBPI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|