C19H36 — CID 59096410
(3S,5R)-1,3,5,7,9,11-hexamethylbicyclo[5.5.1]tridecane (PubChem CID 59096410) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is (3S,5R)-1,3,5,7,9,11-hexamethylbicyclo[5.5.1]tridecane.
| Compound Name | (3S,5R)-1,3,5,7,9,11-hexamethylbicyclo[5.5.1]tridecane |
|---|---|
| PubChem CID | 59096410 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | (3S,5R)-1,3,5,7,9,11-hexamethylbicyclo[5.5.1]tridecane |
| SMILES | CC1CC(C)CC2(C)C[C@@H](C)C[C@@H](C)CC(C)(C1)C2 |
| InChI | InChI=1S/C19H36/c1-14-7-15(2)10-19(6)12-17(4)8-16(3)11-18(5,9-14)13-19/h14-17H,7-13H2,1-6H3/t14-,15+,16?,17?,18?,19? |
| InChIKey | MSFJLGCOKQMBAX-UDMZOXDJSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |