About trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane
trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane (PubChem CID 6427704) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane.
Analyze trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane?
The IUPAC name of trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane (CID 6427704) is trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane.
What is the SMILES notation for trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane?
The canonical SMILES for trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane is C[C@H]1C[C@H](C)C(C)(C)C1.
What is the InChIKey of trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane?
The InChIKey is AVBGIJNNMIBMQG-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H18/c1-7-5-8(2)9(3,4)6-7/h7-8H,5-6H2,1-4H3/t7-,8-/m0/s1.
What are the key properties of trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane?
trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane has a molecular weight of 126.24 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,4S)-1,1,2,4-tetramethylcyclopentane is sourced from PubChem (CID 6427704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).