C12H24 — CID 177145950
cis-(2R,4S)-1,1,2,4-tetramethylcyclohexane;ethene (PubChem CID 177145950) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is cis-(2R,4S)-1,1,2,4-tetramethylcyclohexane;ethene.
| Compound Name | cis-(2R,4S)-1,1,2,4-tetramethylcyclohexane;ethene |
|---|---|
| PubChem CID | 177145950 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | cis-(2R,4S)-1,1,2,4-tetramethylcyclohexane;ethene |
| SMILES | C=C.C[C@H]1CCC(C)(C)[C@H](C)C1 |
| InChI | InChI=1S/C10H20.C2H4/c1-8-5-6-10(3,4)9(2)7-8;1-2/h8-9H,5-7H2,1-4H3;1-2H2/t8-,9+;/m0./s1 |
| InChIKey | WLNZNOGSHXVBCI-OULXEKPRSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|