C10H21N — CID 125452405
[(1S,2S,4R)-1,2,4-trimethylcyclohexyl]methanamine (PubChem CID 125452405) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is [(1S,2S,4R)-1,2,4-trimethylcyclohexyl]methanamine.
| Compound Name | [(1S,2S,4R)-1,2,4-trimethylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 125452405 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | [(1S,2S,4R)-1,2,4-trimethylcyclohexyl]methanamine |
| SMILES | C[C@@H]1CC[C@](C)(CN)[C@@H](C)C1 |
| InChI | InChI=1S/C10H21N/c1-8-4-5-10(3,7-11)9(2)6-8/h8-9H,4-7,11H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | JOBZKTIXQMVYJL-KXUCPTDWSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |