C15H32N+ — CID 176650635
triethyl-(3,4,4-trimethylcyclohexyl)azanium (PubChem CID 176650635) has the molecular formula C15H32N+ and a molecular weight of 226.43 g/mol. Its IUPAC name is triethyl-(3,4,4-trimethylcyclohexyl)azanium.
| Compound Name | triethyl-(3,4,4-trimethylcyclohexyl)azanium |
|---|---|
| PubChem CID | 176650635 |
| Molecular Formula | C15H32N+ |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.25 |
| IUPAC Name | triethyl-(3,4,4-trimethylcyclohexyl)azanium |
| SMILES | CC[N+](CC)(CC)C1CCC(C)(C)C(C)C1 |
| InChI | InChI=1S/C15H32N/c1-7-16(8-2,9-3)14-10-11-15(5,6)13(4)12-14/h13-14H,7-12H2,1-6H3/q+1 |
| InChIKey | HOGDLBZCOUDULB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|