About triethyl-(3,4,4-trimethylcyclohexyl)azanium
triethyl-(3,4,4-trimethylcyclohexyl)azanium (PubChem CID 176650635) has the molecular formula C15H32N+
and a molecular weight of 226.43 g/mol. Its IUPAC name is triethyl-(3,4,4-trimethylcyclohexyl)azanium.
Molecular Properties
| Compound Name | triethyl-(3,4,4-trimethylcyclohexyl)azanium |
| PubChem CID | 176650635 |
| Molecular Formula | C15H32N+ |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.25 |
| IUPAC Name | triethyl-(3,4,4-trimethylcyclohexyl)azanium |
| SMILES | CC[N+](CC)(CC)C1CCC(C)(C)C(C)C1 |
| InChI | InChI=1S/C15H32N/c1-7-16(8-2,9-3)14-10-11-15(5,6)13(4)12-14/h13-14H,7-12H2,1-6H3/q+1 |
| InChIKey | HOGDLBZCOUDULB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-(3,4,4-trimethylcyclohexyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-(3,4,4-trimethylcyclohexyl)azanium?
The IUPAC name of triethyl-(3,4,4-trimethylcyclohexyl)azanium (CID 176650635) is triethyl-(3,4,4-trimethylcyclohexyl)azanium.
What is the SMILES notation for triethyl-(3,4,4-trimethylcyclohexyl)azanium?
The canonical SMILES for triethyl-(3,4,4-trimethylcyclohexyl)azanium is CC[N+](CC)(CC)C1CCC(C)(C)C(C)C1.
What is the InChIKey of triethyl-(3,4,4-trimethylcyclohexyl)azanium?
The InChIKey is HOGDLBZCOUDULB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N/c1-7-16(8-2,9-3)14-10-11-15(5,6)13(4)12-14/h13-14H,7-12H2,1-6H3/q+1.
What are the key properties of triethyl-(3,4,4-trimethylcyclohexyl)azanium?
triethyl-(3,4,4-trimethylcyclohexyl)azanium has a molecular weight of 226.43 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-(3,4,4-trimethylcyclohexyl)azanium is sourced from PubChem (CID 176650635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).