C31H60I2N2 — CID 6187
[(8R,10S,13S)-10,13-dimethyl-3-(triethylazaniumyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-triethylazanium diiodide (PubChem CID 6187) has the molecular formula C31H60I2N2 and a molecular weight of 714.64 g/mol. Its IUPAC name is [(8R,10S,13S)-10,13-dimethyl-3-(triethylazaniumyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-triethylazanium diiodide.
| Compound Name | [(8R,10S,13S)-10,13-dimethyl-3-(triethylazaniumyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-triethylazanium diiodide |
|---|---|
| PubChem CID | 6187 |
| Molecular Formula | C31H60I2N2 |
| Molecular Weight | 714.64 g/mol |
| Exact Mass | 714.28 |
| IUPAC Name | [(8R,10S,13S)-10,13-dimethyl-3-(triethylazaniumyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-triethylazanium diiodide |
| SMILES | CC[N+](CC)(CC)C1CC[C@@]2(C)C(CC[C@@H]3C2CC[C@@]2(C)C3CCC2[N+](CC)(CC)CC)C1.[I-].[I-] |
| InChI | InChI=1S/C31H60N2.2HI/c1-9-32(10-2,11-3)25-19-21-30(7)24(23-25)15-16-26-27-17-18-29(33(12-4,13-5)14-6)31(27,8)22-20-28(26)30;;/h24-29H,9-23H2,1-8H3;2*1H/q+2;;/p-2/t24?,25?,26-,27?,28?,29?,30-,31-;;/m0../s1 |
| InChIKey | DKVXSDORMFRGRX-YAFOLJSWSA-L |
| XLogP | 1.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.64 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|