C14H16N2 — CID 139970843
tetracyclo[6.2.1.13,6.02,7]dodecane-2,7-dicarbonitrile (PubChem CID 139970843) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is tetracyclo[6.2.1.13,6.02,7]dodecane-2,7-dicarbonitrile.
| Compound Name | tetracyclo[6.2.1.13,6.02,7]dodecane-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 139970843 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | tetracyclo[6.2.1.13,6.02,7]dodecane-2,7-dicarbonitrile |
| SMILES | N#CC12C3CCC(C3)C1(C#N)C1CCC2C1 |
| InChI | InChI=1S/C14H16N2/c15-7-13-9-1-2-10(5-9)14(13,8-16)12-4-3-11(13)6-12/h9-12H,1-6H2 |
| InChIKey | MEIDYXCJCFMLAQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|