C10H12O2 — CID 163985504
3,9-dioxapentacyclo[5.3.1.12,4.02,6.08,10]dodecane (PubChem CID 163985504) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 3,9-dioxapentacyclo[5.3.1.12,4.02,6.08,10]dodecane.
| Compound Name | 3,9-dioxapentacyclo[5.3.1.12,4.02,6.08,10]dodecane |
|---|---|
| PubChem CID | 163985504 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3,9-dioxapentacyclo[5.3.1.12,4.02,6.08,10]dodecane |
| SMILES | C1C2CC3(O2)C1C1CC3C2OC12 |
| InChI | InChI=1S/C10H12O2/c1-4-3-10(12-4)6(1)5-2-7(10)9-8(5)11-9/h4-9H,1-3H2 |
| InChIKey | TVYHTQNGVKWTAB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|