C8H8ClNO — CID 98572892
(1S,2R,4R,5S,6S)-6-chloro-3-oxatricyclo[3.2.1.02,4]octane-6-carbonitrile (PubChem CID 98572892) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is (1S,2R,4R,5S,6S)-6-chloro-3-oxatricyclo[3.2.1.02,4]octane-6-carbonitrile.
| Compound Name | (1S,2R,4R,5S,6S)-6-chloro-3-oxatricyclo[3.2.1.02,4]octane-6-carbonitrile |
|---|---|
| PubChem CID | 98572892 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | (1S,2R,4R,5S,6S)-6-chloro-3-oxatricyclo[3.2.1.02,4]octane-6-carbonitrile |
| SMILES | N#C[C@]1(Cl)C[C@@H]2C[C@H]1[C@H]1O[C@H]21 |
| InChI | InChI=1S/C8H8ClNO/c9-8(3-10)2-4-1-5(8)7-6(4)11-7/h4-7H,1-2H2/t4-,5-,6+,7+,8+/m0/s1 |
| InChIKey | MWHLSWVUCYUGOS-TVNFTVLESA-N |
| XLogP | 1.29 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|