C12H22O2 — CID 177226765
ethane;4-methyl-3,5-dioxatricyclo[5.2.2.02,6]undecane (PubChem CID 177226765) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;4-methyl-3,5-dioxatricyclo[5.2.2.02,6]undecane.
| Compound Name | ethane;4-methyl-3,5-dioxatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 177226765 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;4-methyl-3,5-dioxatricyclo[5.2.2.02,6]undecane |
| SMILES | CC.CC1OC2C3CCC(CC3)C2O1 |
| InChI | InChI=1S/C10H16O2.C2H6/c1-6-11-9-7-2-3-8(5-4-7)10(9)12-6;1-2/h6-10H,2-5H2,1H3;1-2H3 |
| InChIKey | CXRQHHYZQUYEBU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |