C7H14Br2O3 — CID 139147591
dibromomethane;2,4,6-trimethyl-1,3,5-trioxane (PubChem CID 139147591) has the molecular formula C7H14Br2O3 and a molecular weight of 305.99 g/mol. Its IUPAC name is dibromomethane;2,4,6-trimethyl-1,3,5-trioxane.
| Compound Name | dibromomethane;2,4,6-trimethyl-1,3,5-trioxane |
|---|---|
| PubChem CID | 139147591 |
| Molecular Formula | C7H14Br2O3 |
| Molecular Weight | 305.99 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | dibromomethane;2,4,6-trimethyl-1,3,5-trioxane |
| SMILES | BrCBr.C[C@H]1O[C@@H](C)O[C@@H](C)O1 |
| InChI | InChI=1S/C6H12O3.CH2Br2/c1-4-7-5(2)9-6(3)8-4;2-1-3/h4-6H,1-3H3;1H2/t4-,5+,6-; |
| InChIKey | LELVMGSOSIZAGA-DKRSLUPJSA-N |
| XLogP | 2.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.99 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|