C12H21O3W3-3 — CID 159571536
ethylidenetungsten;2,4,6-trimethyl-1,3,5-trioxane (PubChem CID 159571536) has the molecular formula C12H21O3W3-3 and a molecular weight of 764.82 g/mol. Its IUPAC name is ethylidenetungsten;2,4,6-trimethyl-1,3,5-trioxane.
| Compound Name | ethylidenetungsten;2,4,6-trimethyl-1,3,5-trioxane |
|---|---|
| PubChem CID | 159571536 |
| Molecular Formula | C12H21O3W3-3 |
| Molecular Weight | 764.82 g/mol |
| Exact Mass | 765.00 |
| IUPAC Name | ethylidenetungsten;2,4,6-trimethyl-1,3,5-trioxane |
| SMILES | CC1OC(C)OC(C)O1.C[C-]=[W].C[C-]=[W].C[C-]=[W] |
| InChI | InChI=1S/C6H12O3.3C2H3.3W/c1-4-7-5(2)9-6(3)8-4;3*1-2;;;/h4-6H,1-3H3;3*1H3;;;/q;3*-1;;; |
| InChIKey | WYHIHCRNSRJSOL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.82 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|