About 4,5-dimethoxy-2-methyl-1,3-dioxolane
4,5-dimethoxy-2-methyl-1,3-dioxolane (PubChem CID 66843015) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4,5-dimethoxy-2-methyl-1,3-dioxolane |
| PubChem CID | 66843015 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4,5-dimethoxy-2-methyl-1,3-dioxolane |
| SMILES | COC1OC(C)OC1OC |
| InChI | InChI=1S/C6H12O4/c1-4-9-5(7-2)6(8-3)10-4/h4-6H,1-3H3 |
| InChIKey | YDUZECHOAIWLOS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethoxy-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxy-2-methyl-1,3-dioxolane?
The IUPAC name of 4,5-dimethoxy-2-methyl-1,3-dioxolane (CID 66843015) is 4,5-dimethoxy-2-methyl-1,3-dioxolane.
What is the SMILES notation for 4,5-dimethoxy-2-methyl-1,3-dioxolane?
The canonical SMILES for 4,5-dimethoxy-2-methyl-1,3-dioxolane is COC1OC(C)OC1OC.
What is the InChIKey of 4,5-dimethoxy-2-methyl-1,3-dioxolane?
The InChIKey is YDUZECHOAIWLOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4/c1-4-9-5(7-2)6(8-3)10-4/h4-6H,1-3H3.
What are the key properties of 4,5-dimethoxy-2-methyl-1,3-dioxolane?
4,5-dimethoxy-2-methyl-1,3-dioxolane has a molecular weight of 148.16 g/mol, XLogP of 0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-2-methyl-1,3-dioxolane is sourced from PubChem (CID 66843015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).