C6H12O4 — CID 66843015
4,5-dimethoxy-2-methyl-1,3-dioxolane (PubChem CID 66843015) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methyl-1,3-dioxolane.
| Compound Name | 4,5-dimethoxy-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 66843015 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4,5-dimethoxy-2-methyl-1,3-dioxolane |
| SMILES | COC1OC(C)OC1OC |
| InChI | InChI=1S/C6H12O4/c1-4-9-5(7-2)6(8-3)10-4/h4-6H,1-3H3 |
| InChIKey | YDUZECHOAIWLOS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |