C8H15FO2 — CID 171762055
5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane (PubChem CID 171762055) has the molecular formula C8H15FO2 and a molecular weight of 162.20 g/mol. Its IUPAC name is 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane.
| Compound Name | 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 171762055 |
| Molecular Formula | C8H15FO2 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane |
| SMILES | CC1OC(C)C(CF)C(C)O1 |
| InChI | InChI=1S/C8H15FO2/c1-5-8(4-9)6(2)11-7(3)10-5/h5-8H,4H2,1-3H3 |
| InChIKey | RKFRFUJRACQPEF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |