About 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane
5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane (PubChem CID 171762055) has the molecular formula C8H15FO2
and a molecular weight of 162.20 g/mol. Its IUPAC name is 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane |
| PubChem CID | 171762055 |
| Molecular Formula | C8H15FO2 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane |
| SMILES | CC1OC(C)C(CF)C(C)O1 |
| InChI | InChI=1S/C8H15FO2/c1-5-8(4-9)6(2)11-7(3)10-5/h5-8H,4H2,1-3H3 |
| InChIKey | RKFRFUJRACQPEF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane?
The IUPAC name of 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane (CID 171762055) is 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane.
What is the SMILES notation for 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane?
The canonical SMILES for 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane is CC1OC(C)C(CF)C(C)O1.
What is the InChIKey of 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane?
The InChIKey is RKFRFUJRACQPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FO2/c1-5-8(4-9)6(2)11-7(3)10-5/h5-8H,4H2,1-3H3.
What are the key properties of 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane?
5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane has a molecular weight of 162.20 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(fluoromethyl)-2,4,6-trimethyl-1,3-dioxane is sourced from PubChem (CID 171762055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).