About 2-chloro-3-methyloxirane;hydrazine
2-chloro-3-methyloxirane;hydrazine (PubChem CID 157079115) has the molecular formula C3H9ClN2O
and a molecular weight of 124.57 g/mol. Its IUPAC name is 2-chloro-3-methyloxirane;hydrazine.
Molecular Properties
| Compound Name | 2-chloro-3-methyloxirane;hydrazine |
| PubChem CID | 157079115 |
| Molecular Formula | C3H9ClN2O |
| Molecular Weight | 124.57 g/mol |
| Exact Mass | 124.04 |
| IUPAC Name | 2-chloro-3-methyloxirane;hydrazine |
| SMILES | CC1OC1Cl.NN |
| InChI | InChI=1S/C3H5ClO.H4N2/c1-2-3(4)5-2;1-2/h2-3H,1H3;1-2H2 |
| InChIKey | ADHXWZZYCCKMPV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.57 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methyloxirane;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyloxirane;hydrazine?
The IUPAC name of 2-chloro-3-methyloxirane;hydrazine (CID 157079115) is 2-chloro-3-methyloxirane;hydrazine.
What is the SMILES notation for 2-chloro-3-methyloxirane;hydrazine?
The canonical SMILES for 2-chloro-3-methyloxirane;hydrazine is CC1OC1Cl.NN.
What is the InChIKey of 2-chloro-3-methyloxirane;hydrazine?
The InChIKey is ADHXWZZYCCKMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO.H4N2/c1-2-3(4)5-2;1-2/h2-3H,1H3;1-2H2.
What are the key properties of 2-chloro-3-methyloxirane;hydrazine?
2-chloro-3-methyloxirane;hydrazine has a molecular weight of 124.57 g/mol, XLogP of -0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyloxirane;hydrazine is sourced from PubChem (CID 157079115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).