About 2-chloro-3-methyloxirane;formazan
2-chloro-3-methyloxirane;formazan (PubChem CID 174932645) has the molecular formula C5H13ClN8O
and a molecular weight of 236.67 g/mol. Its IUPAC name is 2-chloro-3-methyloxirane;formazan.
Molecular Properties
| Compound Name | 2-chloro-3-methyloxirane;formazan |
| PubChem CID | 174932645 |
| Molecular Formula | C5H13ClN8O |
| Molecular Weight | 236.67 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-chloro-3-methyloxirane;formazan |
| SMILES | CC1OC1Cl.[H]/N=N/C=NN.[H]/N=N/C=NN |
| InChI | InChI=1S/C3H5ClO.2CH4N4/c1-2-3(4)5-2;2*2-4-1-5-3/h2-3H,1H3;2*1-2H,3H2/b;2*4-2+,5-1? |
| InChIKey | IUEBCTLZGQBURZ-KIYSNALSSA-N |
| XLogP | 0.81 |
| TPSA | 161.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methyloxirane;formazan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyloxirane;formazan?
The IUPAC name of 2-chloro-3-methyloxirane;formazan (CID 174932645) is 2-chloro-3-methyloxirane;formazan.
What is the SMILES notation for 2-chloro-3-methyloxirane;formazan?
The canonical SMILES for 2-chloro-3-methyloxirane;formazan is CC1OC1Cl.[H]/N=N/C=NN.[H]/N=N/C=NN.
What is the InChIKey of 2-chloro-3-methyloxirane;formazan?
The InChIKey is IUEBCTLZGQBURZ-KIYSNALSSA-N. The full InChI is InChI=1S/C3H5ClO.2CH4N4/c1-2-3(4)5-2;2*2-4-1-5-3/h2-3H,1H3;2*1-2H,3H2/b;2*4-2+,5-1?.
What are the key properties of 2-chloro-3-methyloxirane;formazan?
2-chloro-3-methyloxirane;formazan has a molecular weight of 236.67 g/mol, XLogP of 0.81, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyloxirane;formazan is sourced from PubChem (CID 174932645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).