About benzene;benzene-1,2-diamine;formazan
benzene;benzene-1,2-diamine;formazan (PubChem CID 158623195) has the molecular formula C14H22N10
and a molecular weight of 330.40 g/mol. Its IUPAC name is benzene;benzene-1,2-diamine;formazan.
Molecular Properties
| Compound Name | benzene;benzene-1,2-diamine;formazan |
| PubChem CID | 158623195 |
| Molecular Formula | C14H22N10 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | benzene;benzene-1,2-diamine;formazan |
| SMILES | Nc1ccccc1N.[H]/N=N/C=NN.[H]/N=N/C=NN.c1ccccc1 |
| InChI | InChI=1S/C6H8N2.C6H6.2CH4N4/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1;2*2-4-1-5-3/h1-4H,7-8H2;1-6H;2*1-2H,3H2/b;;2*4-2+,5-1? |
| InChIKey | HYGJCMGQYVRVIC-WXBPMOIISA-N |
| XLogP | 2.38 |
| TPSA | 201.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze benzene;benzene-1,2-diamine;formazan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;benzene-1,2-diamine;formazan?
The IUPAC name of benzene;benzene-1,2-diamine;formazan (CID 158623195) is benzene;benzene-1,2-diamine;formazan.
What is the SMILES notation for benzene;benzene-1,2-diamine;formazan?
The canonical SMILES for benzene;benzene-1,2-diamine;formazan is Nc1ccccc1N.[H]/N=N/C=NN.[H]/N=N/C=NN.c1ccccc1.
What is the InChIKey of benzene;benzene-1,2-diamine;formazan?
The InChIKey is HYGJCMGQYVRVIC-WXBPMOIISA-N. The full InChI is InChI=1S/C6H8N2.C6H6.2CH4N4/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1;2*2-4-1-5-3/h1-4H,7-8H2;1-6H;2*1-2H,3H2/b;;2*4-2+,5-1?.
What are the key properties of benzene;benzene-1,2-diamine;formazan?
benzene;benzene-1,2-diamine;formazan has a molecular weight of 330.40 g/mol, XLogP of 2.38, 2 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;benzene-1,2-diamine;formazan is sourced from PubChem (CID 158623195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).