About 3-amino-2-methylphenol;formazan
3-amino-2-methylphenol;formazan (PubChem CID 157254660) has the molecular formula C9H17N9O
and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-amino-2-methylphenol;formazan.
Molecular Properties
| Compound Name | 3-amino-2-methylphenol;formazan |
| PubChem CID | 157254660 |
| Molecular Formula | C9H17N9O |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-amino-2-methylphenol;formazan |
| SMILES | Cc1c(N)cccc1O.[H]/N=N/C=NN.[H]/N=N/C=NN |
| InChI | InChI=1S/C7H9NO.2CH4N4/c1-5-6(8)3-2-4-7(5)9;2*2-4-1-5-3/h2-4,9H,8H2,1H3;2*1-2H,3H2/b;2*4-2+,5-1? |
| InChIKey | AWTCPFOORVODRL-KIYSNALSSA-N |
| XLogP | 1.12 |
| TPSA | 195.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-methylphenol;formazan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methylphenol;formazan?
The IUPAC name of 3-amino-2-methylphenol;formazan (CID 157254660) is 3-amino-2-methylphenol;formazan.
What is the SMILES notation for 3-amino-2-methylphenol;formazan?
The canonical SMILES for 3-amino-2-methylphenol;formazan is Cc1c(N)cccc1O.[H]/N=N/C=NN.[H]/N=N/C=NN.
What is the InChIKey of 3-amino-2-methylphenol;formazan?
The InChIKey is AWTCPFOORVODRL-KIYSNALSSA-N. The full InChI is InChI=1S/C7H9NO.2CH4N4/c1-5-6(8)3-2-4-7(5)9;2*2-4-1-5-3/h2-4,9H,8H2,1H3;2*1-2H,3H2/b;2*4-2+,5-1?.
What are the key properties of 3-amino-2-methylphenol;formazan?
3-amino-2-methylphenol;formazan has a molecular weight of 267.30 g/mol, XLogP of 1.12, 2 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methylphenol;formazan is sourced from PubChem (CID 157254660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).