About 2-chloro-3-methyloxirane;prop-2-en-1-amine
2-chloro-3-methyloxirane;prop-2-en-1-amine (PubChem CID 175326390) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is 2-chloro-3-methyloxirane;prop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-chloro-3-methyloxirane;prop-2-en-1-amine |
| PubChem CID | 175326390 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2-chloro-3-methyloxirane;prop-2-en-1-amine |
| SMILES | C=CCN.CC1OC1Cl |
| InChI | InChI=1S/C3H5ClO.C3H7N/c1-2-3(4)5-2;1-2-3-4/h2-3H,1H3;2H,1,3-4H2 |
| InChIKey | VFGVHUQEIQJBQL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methyloxirane;prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyloxirane;prop-2-en-1-amine?
The IUPAC name of 2-chloro-3-methyloxirane;prop-2-en-1-amine (CID 175326390) is 2-chloro-3-methyloxirane;prop-2-en-1-amine.
What is the SMILES notation for 2-chloro-3-methyloxirane;prop-2-en-1-amine?
The canonical SMILES for 2-chloro-3-methyloxirane;prop-2-en-1-amine is C=CCN.CC1OC1Cl.
What is the InChIKey of 2-chloro-3-methyloxirane;prop-2-en-1-amine?
The InChIKey is VFGVHUQEIQJBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO.C3H7N/c1-2-3(4)5-2;1-2-3-4/h2-3H,1H3;2H,1,3-4H2.
What are the key properties of 2-chloro-3-methyloxirane;prop-2-en-1-amine?
2-chloro-3-methyloxirane;prop-2-en-1-amine has a molecular weight of 149.62 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyloxirane;prop-2-en-1-amine is sourced from PubChem (CID 175326390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).