About formazan;propan-2-one
formazan;propan-2-one (PubChem CID 157309137) has the molecular formula C5H14N8O
and a molecular weight of 202.22 g/mol. Its IUPAC name is formazan;propan-2-one.
Molecular Properties
| Compound Name | formazan;propan-2-one |
| PubChem CID | 157309137 |
| Molecular Formula | C5H14N8O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | formazan;propan-2-one |
| SMILES | CC(C)=O.[H]/N=N/C=NN.[H]/N=N/C=NN |
| InChI | InChI=1S/C3H6O.2CH4N4/c1-3(2)4;2*2-4-1-5-3/h1-2H3;2*1-2H,3H2/b;2*4-2+,5-1? |
| InChIKey | BCVITJDFYOLHNM-KIYSNALSSA-N |
| XLogP | 0.43 |
| TPSA | 166.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze formazan;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formazan;propan-2-one?
The IUPAC name of formazan;propan-2-one (CID 157309137) is formazan;propan-2-one.
What is the SMILES notation for formazan;propan-2-one?
The canonical SMILES for formazan;propan-2-one is CC(C)=O.[H]/N=N/C=NN.[H]/N=N/C=NN.
What is the InChIKey of formazan;propan-2-one?
The InChIKey is BCVITJDFYOLHNM-KIYSNALSSA-N. The full InChI is InChI=1S/C3H6O.2CH4N4/c1-3(2)4;2*2-4-1-5-3/h1-2H3;2*1-2H,3H2/b;2*4-2+,5-1?.
What are the key properties of formazan;propan-2-one?
formazan;propan-2-one has a molecular weight of 202.22 g/mol, XLogP of 0.43, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for formazan;propan-2-one is sourced from PubChem (CID 157309137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).