About formazan;2-methylprop-2-enoic acid
formazan;2-methylprop-2-enoic acid (PubChem CID 159809417) has the molecular formula C5H10N4O2
and a molecular weight of 158.16 g/mol. Its IUPAC name is formazan;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | formazan;2-methylprop-2-enoic acid |
| PubChem CID | 159809417 |
| Molecular Formula | C5H10N4O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | formazan;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.[H]/N=N/C=NN |
| InChI | InChI=1S/C4H6O2.CH4N4/c1-3(2)4(5)6;2-4-1-5-3/h1H2,2H3,(H,5,6);1-2H,3H2/b;4-2+,5-1? |
| InChIKey | NKVGXFZHMFEZEL-CTELUNINSA-N |
| XLogP | 0.57 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze formazan;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formazan;2-methylprop-2-enoic acid?
The IUPAC name of formazan;2-methylprop-2-enoic acid (CID 159809417) is formazan;2-methylprop-2-enoic acid.
What is the SMILES notation for formazan;2-methylprop-2-enoic acid?
The canonical SMILES for formazan;2-methylprop-2-enoic acid is C=C(C)C(=O)O.[H]/N=N/C=NN.
What is the InChIKey of formazan;2-methylprop-2-enoic acid?
The InChIKey is NKVGXFZHMFEZEL-CTELUNINSA-N. The full InChI is InChI=1S/C4H6O2.CH4N4/c1-3(2)4(5)6;2-4-1-5-3/h1H2,2H3,(H,5,6);1-2H,3H2/b;4-2+,5-1?.
What are the key properties of formazan;2-methylprop-2-enoic acid?
formazan;2-methylprop-2-enoic acid has a molecular weight of 158.16 g/mol, XLogP of 0.57, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formazan;2-methylprop-2-enoic acid is sourced from PubChem (CID 159809417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).