About 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium
2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium (PubChem CID 174978465) has the molecular formula C12H27ClNO2+
and a molecular weight of 252.81 g/mol. Its IUPAC name is 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium.
Molecular Properties
| Compound Name | 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium |
| PubChem CID | 174978465 |
| Molecular Formula | C12H27ClNO2+ |
| Molecular Weight | 252.81 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium |
| SMILES | CC1OC1Cl.CC[N+](CC)(CC)CC(C)O |
| InChI | InChI=1S/C9H22NO.C3H5ClO/c1-5-10(6-2,7-3)8-9(4)11;1-2-3(4)5-2/h9,11H,5-8H2,1-4H3;2-3H,1H3/q+1; |
| InChIKey | DONHJRWEXMQGRI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium?
The IUPAC name of 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium (CID 174978465) is 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium.
What is the SMILES notation for 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium?
The canonical SMILES for 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium is CC1OC1Cl.CC[N+](CC)(CC)CC(C)O.
What is the InChIKey of 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium?
The InChIKey is DONHJRWEXMQGRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22NO.C3H5ClO/c1-5-10(6-2,7-3)8-9(4)11;1-2-3(4)5-2/h9,11H,5-8H2,1-4H3;2-3H,1H3/q+1;.
What are the key properties of 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium?
2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium has a molecular weight of 252.81 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyloxirane;triethyl(2-hydroxypropyl)azanium is sourced from PubChem (CID 174978465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).