About diethyl-bis(2-methylpropyl)azanium;hafnium
diethyl-bis(2-methylpropyl)azanium;hafnium (PubChem CID 174652205) has the molecular formula C12H28HfN+
and a molecular weight of 364.85 g/mol. Its IUPAC name is diethyl-bis(2-methylpropyl)azanium;hafnium.
Molecular Properties
| Compound Name | diethyl-bis(2-methylpropyl)azanium;hafnium |
| PubChem CID | 174652205 |
| Molecular Formula | C12H28HfN+ |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | diethyl-bis(2-methylpropyl)azanium;hafnium |
| SMILES | CC[N+](CC)(CC(C)C)CC(C)C.[Hf] |
| InChI | InChI=1S/C12H28N.Hf/c1-7-13(8-2,9-11(3)4)10-12(5)6;/h11-12H,7-10H2,1-6H3;/q+1; |
| InChIKey | USLOBNLRUNWRCY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-bis(2-methylpropyl)azanium;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-bis(2-methylpropyl)azanium;hafnium?
The IUPAC name of diethyl-bis(2-methylpropyl)azanium;hafnium (CID 174652205) is diethyl-bis(2-methylpropyl)azanium;hafnium.
What is the SMILES notation for diethyl-bis(2-methylpropyl)azanium;hafnium?
The canonical SMILES for diethyl-bis(2-methylpropyl)azanium;hafnium is CC[N+](CC)(CC(C)C)CC(C)C.[Hf].
What is the InChIKey of diethyl-bis(2-methylpropyl)azanium;hafnium?
The InChIKey is USLOBNLRUNWRCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.Hf/c1-7-13(8-2,9-11(3)4)10-12(5)6;/h11-12H,7-10H2,1-6H3;/q+1;.
What are the key properties of diethyl-bis(2-methylpropyl)azanium;hafnium?
diethyl-bis(2-methylpropyl)azanium;hafnium has a molecular weight of 364.85 g/mol, XLogP of 3.15, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-bis(2-methylpropyl)azanium;hafnium is sourced from PubChem (CID 174652205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).