C4H6Cl2O2 — CID 54239715
4,5-dichloro-2-methyl-1,3-dioxolane (PubChem CID 54239715) has the molecular formula C4H6Cl2O2 and a molecular weight of 157.00 g/mol. Its IUPAC name is 4,5-dichloro-2-methyl-1,3-dioxolane.
| Compound Name | 4,5-dichloro-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 54239715 |
| Molecular Formula | C4H6Cl2O2 |
| Molecular Weight | 157.00 g/mol |
| Exact Mass | 155.97 |
| IUPAC Name | 4,5-dichloro-2-methyl-1,3-dioxolane |
| SMILES | CC1OC(Cl)C(Cl)O1 |
| InChI | InChI=1S/C4H6Cl2O2/c1-2-7-3(5)4(6)8-2/h2-4H,1H3 |
| InChIKey | QPDBMKOAOGPMJF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.00 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|