C3H3Cl3O — CID 175014786
2,3,4-trichlorooxetane (PubChem CID 175014786) has the molecular formula C3H3Cl3O and a molecular weight of 161.42 g/mol. Its IUPAC name is 2,3,4-trichlorooxetane.
| Compound Name | 2,3,4-trichlorooxetane |
|---|---|
| PubChem CID | 175014786 |
| Molecular Formula | C3H3Cl3O |
| Molecular Weight | 161.42 g/mol |
| Exact Mass | 159.92 |
| IUPAC Name | 2,3,4-trichlorooxetane |
| SMILES | ClC1OC(Cl)C1Cl |
| InChI | InChI=1S/C3H3Cl3O/c4-1-2(5)7-3(1)6/h1-3H |
| InChIKey | GPOMVYYSZNBVFF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|