C9H4Cl8O — CID 121493397
(1S,2S,3S,5S,6R,7S)-1,3,5,7,8,9,10,10-octachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 121493397) has the molecular formula C9H4Cl8O and a molecular weight of 411.75 g/mol. Its IUPAC name is (1S,2S,3S,5S,6R,7S)-1,3,5,7,8,9,10,10-octachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1S,2S,3S,5S,6R,7S)-1,3,5,7,8,9,10,10-octachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 121493397 |
| Molecular Formula | C9H4Cl8O |
| Molecular Weight | 411.75 g/mol |
| Exact Mass | 407.78 |
| IUPAC Name | (1S,2S,3S,5S,6R,7S)-1,3,5,7,8,9,10,10-octachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@H]3[C@H]([C@H](Cl)O[C@H]3Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C9H4Cl8O/c10-3-4(11)8(15)2-1(5(12)18-6(2)13)7(3,14)9(8,16)17/h1-2,5-6H/t1-,2+,5-,6-,7+,8+/m1/s1 |
| InChIKey | LRWHHSXTGZSMSN-UTNCJWAVSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|