C10H5Cl7O — CID 91747989
(2S,3R,5R,7R)-1,6,8,9,10,11,11-heptachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene (PubChem CID 91747989) has the molecular formula C10H5Cl7O and a molecular weight of 389.32 g/mol. Its IUPAC name is (2S,3R,5R,7R)-1,6,8,9,10,11,11-heptachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene.
| Compound Name | (2S,3R,5R,7R)-1,6,8,9,10,11,11-heptachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene |
|---|---|
| PubChem CID | 91747989 |
| Molecular Formula | C10H5Cl7O |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 385.82 |
| IUPAC Name | (2S,3R,5R,7R)-1,6,8,9,10,11,11-heptachloro-4-oxatetracyclo[6.2.1.02,7.03,5]undec-9-ene |
| SMILES | ClC1=C(Cl)C2(Cl)[C@H]3C(Cl)[C@@H]4O[C@@H]4[C@H]3C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H5Cl7O/c11-3-1-2(4-5(3)18-4)9(15)7(13)6(12)8(1,14)10(9,16)17/h1-5H/t1-,2+,3?,4-,5+,8?,9?/m1/s1 |
| InChIKey | ZXFXBSWRVIQKOD-BXWJSMNRSA-N |
| XLogP | 4.45 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|