C12H8Cl6O2 — CID 98457772
(1R,2S,3S,6S,7R,8R,9S,11R)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-ol (PubChem CID 98457772) has the molecular formula C12H8Cl6O2 and a molecular weight of 396.91 g/mol. Its IUPAC name is (1R,2S,3S,6S,7R,8R,9S,11R)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-ol.
| Compound Name | (1R,2S,3S,6S,7R,8R,9S,11R)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-ol |
|---|---|
| PubChem CID | 98457772 |
| Molecular Formula | C12H8Cl6O2 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | (1R,2S,3S,6S,7R,8R,9S,11R)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-ol |
| SMILES | OC1[C@@H]2[C@@H]3O[C@@H]3[C@@H]1[C@H]1[C@@H]2[C@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C12H8Cl6O2/c13-8-9(14)11(16)4-2-5(19)1(6-7(2)20-6)3(4)10(8,15)12(11,17)18/h1-7,19H/t1-,2-,3-,4+,5?,6+,7-,10+,11+/m1/s1 |
| InChIKey | VRHKKHANKOOSAH-FVVBABMKSA-N |
| XLogP | 3.45 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|