C10H6Cl6O — CID 100972507
(1R,2R,3S,6R,7S)-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]deca-4,8-dien-3-ol (PubChem CID 100972507) has the molecular formula C10H6Cl6O and a molecular weight of 354.88 g/mol. Its IUPAC name is (1R,2R,3S,6R,7S)-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]deca-4,8-dien-3-ol.
| Compound Name | (1R,2R,3S,6R,7S)-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
|---|---|
| PubChem CID | 100972507 |
| Molecular Formula | C10H6Cl6O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 351.85 |
| IUPAC Name | (1R,2R,3S,6R,7S)-1,7,8,9,10,10-hexachlorotricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
| SMILES | O[C@H]1C=C[C@@H]2[C@H]1[C@@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C10H6Cl6O/c11-6-7(12)9(14)5-3(1-2-4(5)17)8(6,13)10(9,15)16/h1-5,17H/t3-,4+,5-,8+,9-/m1/s1 |
| InChIKey | YQWCIPIEEBVRNY-IYSJDXJNSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|