C10H5Cl7 — CID 98051205
(1S,2R,5R,6S,7S)-1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 98051205) has the molecular formula C10H5Cl7 and a molecular weight of 373.32 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1S,2R,5R,6S,7S)-1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 98051205 |
| Molecular Formula | C10H5Cl7 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 369.82 |
| IUPAC Name | (1S,2R,5R,6S,7S)-1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@@H]3C=C[C@@H](Cl)[C@H]3[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H5Cl7/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17/h1-5H/t3-,4-,5+,8+,9+/m1/s1 |
| InChIKey | FRCCEHPWNOQAEU-VVZGCNPUSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|