C18H25Cl7N+ — CID 174728146
1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;tetraethylazanium (PubChem CID 174728146) has the molecular formula C18H25Cl7N+ and a molecular weight of 503.58 g/mol. Its IUPAC name is 1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;tetraethylazanium.
| Compound Name | 1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;tetraethylazanium |
|---|---|
| PubChem CID | 174728146 |
| Molecular Formula | C18H25Cl7N+ |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 499.98 |
| IUPAC Name | 1,5,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]deca-3,8-diene;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.ClC1=C(Cl)C2(Cl)C3C(Cl)C=CC3C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H5Cl7.C8H20N/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17;1-5-9(6-2,7-3)8-4/h1-5H;5-8H2,1-4H3/q;+1 |
| InChIKey | KVCVXOSRUQZNHP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|