C14H9Cl6NO4 — CID 44723718
3,4,5,6,15,15-hexachloro-11-methoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 44723718) has the molecular formula C14H9Cl6NO4 and a molecular weight of 467.95 g/mol. Its IUPAC name is 3,4,5,6,15,15-hexachloro-11-methoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | 3,4,5,6,15,15-hexachloro-11-methoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 44723718 |
| Molecular Formula | C14H9Cl6NO4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 464.87 |
| IUPAC Name | 3,4,5,6,15,15-hexachloro-11-methoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | CON1C(=O)C2C3OC(C2C1=O)C1C3C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C14H9Cl6NO4/c1-24-21-10(22)2-3(11(21)23)7-5-4(6(2)25-7)12(17)8(15)9(16)13(5,18)14(12,19)20/h2-7H,1H3 |
| InChIKey | VATHRBPHWZCJHD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|