C17H15Cl6NO4 — CID 6594409
(1R,2S,3R,6R,7R,8S,9R,13S)-11-butoxy-3,4,5,6,15,15-hexachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 6594409) has the molecular formula C17H15Cl6NO4 and a molecular weight of 510.03 g/mol. Its IUPAC name is (1R,2S,3R,6R,7R,8S,9R,13S)-11-butoxy-3,4,5,6,15,15-hexachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | (1R,2S,3R,6R,7R,8S,9R,13S)-11-butoxy-3,4,5,6,15,15-hexachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 6594409 |
| Molecular Formula | C17H15Cl6NO4 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 506.91 |
| IUPAC Name | (1R,2S,3R,6R,7R,8S,9R,13S)-11-butoxy-3,4,5,6,15,15-hexachloro-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | CCCCON1C(=O)[C@@H]2[C@H]3O[C@@H]([C@@H]2C1=O)[C@H]1[C@@H]3[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C17H15Cl6NO4/c1-2-3-4-27-24-13(25)5-6(14(24)26)10-8-7(9(5)28-10)15(20)11(18)12(19)16(8,21)17(15,22)23/h5-10H,2-4H2,1H3/t5-,6+,7-,8+,9+,10-,15-,16-/m1/s1 |
| InChIKey | DHNKALYHIPLSFV-FNHHFHIQSA-N |
| XLogP | 4.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|