C21H23Cl6NO4 — CID 99947921
(1R,2S,3R,6R,7S,8S,9R,13S)-3,4,5,6,15,15-hexachloro-11-octoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 99947921) has the molecular formula C21H23Cl6NO4 and a molecular weight of 566.14 g/mol. Its IUPAC name is (1R,2S,3R,6R,7S,8S,9R,13S)-3,4,5,6,15,15-hexachloro-11-octoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | (1R,2S,3R,6R,7S,8S,9R,13S)-3,4,5,6,15,15-hexachloro-11-octoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 99947921 |
| Molecular Formula | C21H23Cl6NO4 |
| Molecular Weight | 566.14 g/mol |
| Exact Mass | 562.98 |
| IUPAC Name | (1R,2S,3R,6R,7S,8S,9R,13S)-3,4,5,6,15,15-hexachloro-11-octoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | CCCCCCCCON1C(=O)[C@@H]2[C@H]3O[C@@H]([C@@H]2C1=O)[C@@H]1[C@@H]3[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C21H23Cl6NO4/c1-2-3-4-5-6-7-8-31-28-17(29)9-10(18(28)30)14-12-11(13(9)32-14)19(24)15(22)16(23)20(12,25)21(19,26)27/h9-14H,2-8H2,1H3/t9-,10+,11-,12-,13+,14-,19+,20+/m0/s1 |
| InChIKey | CSJQKNNPFKFWLO-MVPRIQTCSA-N |
| XLogP | 5.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.14 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|