C16H23NO4 — CID 98130066
(3aR,4R,7R,7aR)-2-octoxy-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98130066) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (3aR,4R,7R,7aR)-2-octoxy-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aR)-2-octoxy-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98130066 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (3aR,4R,7R,7aR)-2-octoxy-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CCCCCCCCON1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C16H23NO4/c1-2-3-4-5-6-7-10-20-17-15(18)13-11-8-9-12(21-11)14(13)16(17)19/h8-9,11-14H,2-7,10H2,1H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | IFDVXUAAUVKRHQ-MQYQWHSLSA-N |
| XLogP | 2.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|