C18H17Cl6NO4 — CID 3599457
3,4,5,6,15,15-hexachloro-11-pentoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 3599457) has the molecular formula C18H17Cl6NO4 and a molecular weight of 524.06 g/mol. Its IUPAC name is 3,4,5,6,15,15-hexachloro-11-pentoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | 3,4,5,6,15,15-hexachloro-11-pentoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 3599457 |
| Molecular Formula | C18H17Cl6NO4 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 520.93 |
| IUPAC Name | 3,4,5,6,15,15-hexachloro-11-pentoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | CCCCCON1C(=O)C2C3OC(C2C1=O)C1C3C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C18H17Cl6NO4/c1-2-3-4-5-28-25-14(26)6-7(15(25)27)11-9-8(10(6)29-11)16(21)12(19)13(20)17(9,22)18(16,23)24/h6-11H,2-5H2,1H3 |
| InChIKey | IQUSGTPFAJZVHP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|