C12H11Cl4NO3 — CID 98511968
(1R,2S,6R,7R)-1,7,8,9-tetrachloro-4-propoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98511968) has the molecular formula C12H11Cl4NO3 and a molecular weight of 359.04 g/mol. Its IUPAC name is (1R,2S,6R,7R)-1,7,8,9-tetrachloro-4-propoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-1,7,8,9-tetrachloro-4-propoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98511968 |
| Molecular Formula | C12H11Cl4NO3 |
| Molecular Weight | 359.04 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | (1R,2S,6R,7R)-1,7,8,9-tetrachloro-4-propoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCCON1C(=O)[C@@H]2[C@H](C1=O)[C@]1(Cl)C[C@]2(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C12H11Cl4NO3/c1-2-3-20-17-9(18)5-6(10(17)19)12(16)4-11(5,15)7(13)8(12)14/h5-6H,2-4H2,1H3/t5-,6+,11-,12-/m1/s1 |
| InChIKey | YIRYCPGMTQPMOF-ZTABQDSOSA-N |
| XLogP | 2.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.04 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|