C20H15Cl4NO4 — CID 124756569
(1S,2S,3S,6S,7R,8R,9S,13R)-3,4,5,6-tetrachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 124756569) has the molecular formula C20H15Cl4NO4 and a molecular weight of 475.16 g/mol. Its IUPAC name is (1S,2S,3S,6S,7R,8R,9S,13R)-3,4,5,6-tetrachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | (1S,2S,3S,6S,7R,8R,9S,13R)-3,4,5,6-tetrachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 124756569 |
| Molecular Formula | C20H15Cl4NO4 |
| Molecular Weight | 475.16 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | (1S,2S,3S,6S,7R,8R,9S,13R)-3,4,5,6-tetrachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | O=C1[C@@H]2[C@H]3O[C@@H]([C@@H]2C(=O)N1OCc1ccccc1)[C@@H]1[C@H]3[C@@]2(Cl)C[C@@]1(Cl)C(Cl)=C2Cl |
| InChI | InChI=1S/C20H15Cl4NO4/c21-15-16(22)20(24)7-19(15,23)11-12(20)14-10-9(13(11)29-14)17(26)25(18(10)27)28-6-8-4-2-1-3-5-8/h1-5,9-14H,6-7H2/t9-,10+,11+,12-,13+,14-,19-,20-/m0/s1 |
| InChIKey | TWXVBDCWJPOARZ-ATHMVMMMSA-N |
| XLogP | 3.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|