C20H13Cl6NO4 — CID 119079089
(1R,2S,3S,6S,7S,8R,9S,13S)-3,4,5,6,15,15-hexachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione (PubChem CID 119079089) has the molecular formula C20H13Cl6NO4 and a molecular weight of 544.05 g/mol. Its IUPAC name is (1R,2S,3S,6S,7S,8R,9S,13S)-3,4,5,6,15,15-hexachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione.
| Compound Name | (1R,2S,3S,6S,7S,8R,9S,13S)-3,4,5,6,15,15-hexachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
|---|---|
| PubChem CID | 119079089 |
| Molecular Formula | C20H13Cl6NO4 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 540.90 |
| IUPAC Name | (1R,2S,3S,6S,7S,8R,9S,13S)-3,4,5,6,15,15-hexachloro-11-phenylmethoxy-14-oxa-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadec-4-ene-10,12-dione |
| SMILES | O=C1[C@@H]2[C@H]3O[C@H]([C@H]2C(=O)N1OCc1ccccc1)[C@@H]1[C@@H]3[C@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C20H13Cl6NO4/c21-14-15(22)19(24)11-10(18(14,23)20(19,25)26)12-8-9(13(11)31-12)17(29)27(16(8)28)30-6-7-4-2-1-3-5-7/h1-5,8-13H,6H2/t8-,9-,10-,11-,12+,13+,18-,19-/m0/s1 |
| InChIKey | MAAOITAGYHEUEQ-BOYFBWGPSA-N |
| XLogP | 4.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|