C17H15NO4 — CID 11266467
(3aR,4S,7R,7aS)-2-[(E)-3-phenylprop-2-enoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 11266467) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-[(E)-3-phenylprop-2-enoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-[(E)-3-phenylprop-2-enoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11266467 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-[(E)-3-phenylprop-2-enoxy]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1OC/C=C/c1ccccc1)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C17H15NO4/c19-16-14-12-8-9-13(22-12)15(14)17(20)18(16)21-10-4-7-11-5-2-1-3-6-11/h1-9,12-15H,10H2/b7-4+/t12-,13+,14-,15+ |
| InChIKey | BHVNXGPWYQNOQO-YULFRYNTSA-N |
| XLogP | 1.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|