C6H10FIO2 — CID 58758246
(3R,4R,5S)-2-(fluoromethyl)-4-iodo-5-methyloxolan-3-ol (PubChem CID 58758246) has the molecular formula C6H10FIO2 and a molecular weight of 260.05 g/mol. Its IUPAC name is (3R,4R,5S)-2-(fluoromethyl)-4-iodo-5-methyloxolan-3-ol.
| Compound Name | (3R,4R,5S)-2-(fluoromethyl)-4-iodo-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 58758246 |
| Molecular Formula | C6H10FIO2 |
| Molecular Weight | 260.05 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | (3R,4R,5S)-2-(fluoromethyl)-4-iodo-5-methyloxolan-3-ol |
| SMILES | C[C@@H]1OC(CF)[C@@H](O)[C@H]1I |
| InChI | InChI=1S/C6H10FIO2/c1-3-5(8)6(9)4(2-7)10-3/h3-6,9H,2H2,1H3/t3-,4?,5-,6+/m0/s1 |
| InChIKey | GTKFJVJTIQVENH-OBOOZECYSA-N |
| XLogP | 0.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.05 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|