C19H30F2O12 — CID 167554257
[(3R,5R)-4,5-diacetyloxy-6-(fluoromethyl)-2-methyloxan-3-yl] acetate;(3S,5R)-6-(fluoromethyl)oxane-2,3,4,5-tetrol (PubChem CID 167554257) has the molecular formula C19H30F2O12 and a molecular weight of 488.43 g/mol. Its IUPAC name is [(3R,5R)-4,5-diacetyloxy-6-(fluoromethyl)-2-methyloxan-3-yl] acetate;(3S,5R)-6-(fluoromethyl)oxane-2,3,4,5-tetrol.
| Compound Name | [(3R,5R)-4,5-diacetyloxy-6-(fluoromethyl)-2-methyloxan-3-yl] acetate;(3S,5R)-6-(fluoromethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 167554257 |
| Molecular Formula | C19H30F2O12 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [(3R,5R)-4,5-diacetyloxy-6-(fluoromethyl)-2-methyloxan-3-yl] acetate;(3S,5R)-6-(fluoromethyl)oxane-2,3,4,5-tetrol |
| SMILES | CC(=O)OC1[C@H](OC(C)=O)C(C)OC(CF)[C@@H]1OC(C)=O.OC1OC(CF)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C13H19FO7.C6H11FO5/c1-6-11(19-7(2)15)13(21-9(4)17)12(20-8(3)16)10(5-14)18-6;7-1-2-3(8)4(9)5(10)6(11)12-2/h6,10-13H,5H2,1-4H3;2-6,8-11H,1H2/t6?,10?,11-,12+,13?;2?,3-,4?,5-,6?/m10/s1 |
| InChIKey | CUMKVXSCFVXWSK-IKFQRDMBSA-N |
| XLogP | -1.71 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|